C13H25N3O2S2 — CID 88559019
N-[(E)-[2-[2-(tert-butyldisulfanyl)ethylamino]-2-oxoethylidene]amino]-2,2-dimethylpropanamide (PubChem CID 88559019) has the molecular formula C13H25N3O2S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is N-[(E)-[2-[2-(tert-butyldisulfanyl)ethylamino]-2-oxoethylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | N-[(E)-[2-[2-(tert-butyldisulfanyl)ethylamino]-2-oxoethylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 88559019 |
| Molecular Formula | C13H25N3O2S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[(E)-[2-[2-(tert-butyldisulfanyl)ethylamino]-2-oxoethylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)SSCCNC(=O)/C=N/NC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H25N3O2S2/c1-12(2,3)11(18)16-15-9-10(17)14-7-8-19-20-13(4,5)6/h9H,7-8H2,1-6H3,(H,14,17)(H,16,18)/b15-9+ |
| InChIKey | DROGSHIHPCMDMK-OQLLNIDSSA-N |
| XLogP | 2.43 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|