About propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate
propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate (PubChem CID 46910875) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate.
Molecular Properties
| Compound Name | propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate |
| PubChem CID | 46910875 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate |
| SMILES | CC(C)OC(=O)/C=N/NC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H18N2O3/c1-7(2)15-8(13)6-11-12-9(14)10(3,4)5/h6-7H,1-5H3,(H,12,14)/b11-6+ |
| InChIKey | MYNWDTJWBVZNMU-IZZDOVSWSA-N |
| XLogP | 1.09 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate?
The IUPAC name of propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate (CID 46910875) is propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate.
What is the SMILES notation for propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate?
The canonical SMILES for propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate is CC(C)OC(=O)/C=N/NC(=O)C(C)(C)C.
What is the InChIKey of propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate?
The InChIKey is MYNWDTJWBVZNMU-IZZDOVSWSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-7(2)15-8(13)6-11-12-9(14)10(3,4)5/h6-7H,1-5H3,(H,12,14)/b11-6+.
What are the key properties of propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate?
propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate has a molecular weight of 214.26 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2E)-2-(2,2-dimethylpropanoylhydrazinylidene)acetate is sourced from PubChem (CID 46910875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).