C19H32N2O — CID 142937914
4-methoxy-N-(2-methylidenebutyl)-2-[2-methyl-5-(methylamino)pentan-2-yl]aniline (PubChem CID 142937914) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 4-methoxy-N-(2-methylidenebutyl)-2-[2-methyl-5-(methylamino)pentan-2-yl]aniline.
| Compound Name | 4-methoxy-N-(2-methylidenebutyl)-2-[2-methyl-5-(methylamino)pentan-2-yl]aniline |
|---|---|
| PubChem CID | 142937914 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 4-methoxy-N-(2-methylidenebutyl)-2-[2-methyl-5-(methylamino)pentan-2-yl]aniline |
| SMILES | C=C(CC)CNc1ccc(OC)cc1C(C)(C)CCCNC |
| InChI | InChI=1S/C19H32N2O/c1-7-15(2)14-21-18-10-9-16(22-6)13-17(18)19(3,4)11-8-12-20-5/h9-10,13,20-21H,2,7-8,11-12,14H2,1,3-6H3 |
| InChIKey | KGWNOQQZOVGDEL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|