C18H20FN3O — CID 142938073
5-[(E)-1-(ethylideneamino)prop-1-en-2-yl]-3-[(2-fluoro-6-methylphenyl)methoxy]pyridin-2-amine (PubChem CID 142938073) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 5-[(E)-1-(ethylideneamino)prop-1-en-2-yl]-3-[(2-fluoro-6-methylphenyl)methoxy]pyridin-2-amine.
| Compound Name | 5-[(E)-1-(ethylideneamino)prop-1-en-2-yl]-3-[(2-fluoro-6-methylphenyl)methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 142938073 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 5-[(E)-1-(ethylideneamino)prop-1-en-2-yl]-3-[(2-fluoro-6-methylphenyl)methoxy]pyridin-2-amine |
| SMILES | C/C=N/C=C(\C)c1cnc(N)c(OCc2c(C)cccc2F)c1 |
| InChI | InChI=1S/C18H20FN3O/c1-4-21-9-13(3)14-8-17(18(20)22-10-14)23-11-15-12(2)6-5-7-16(15)19/h4-10H,11H2,1-3H3,(H2,20,22)/b13-9+,21-4+ |
| InChIKey | LJCIKUYNCOAENR-YDFWMZAJSA-N |
| XLogP | 4.14 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|