C18H13F3N2O — CID 173171258
5-phenyl-3-[(2,4,6-trifluorophenyl)methoxy]pyridin-2-amine (PubChem CID 173171258) has the molecular formula C18H13F3N2O and a molecular weight of 330.31 g/mol. Its IUPAC name is 5-phenyl-3-[(2,4,6-trifluorophenyl)methoxy]pyridin-2-amine.
| Compound Name | 5-phenyl-3-[(2,4,6-trifluorophenyl)methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 173171258 |
| Molecular Formula | C18H13F3N2O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 5-phenyl-3-[(2,4,6-trifluorophenyl)methoxy]pyridin-2-amine |
| SMILES | Nc1ncc(-c2ccccc2)cc1OCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C18H13F3N2O/c19-13-7-15(20)14(16(21)8-13)10-24-17-6-12(9-23-18(17)22)11-4-2-1-3-5-11/h1-9H,10H2,(H2,22,23) |
| InChIKey | ZYYMMIHXFVTSMG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|