C23H23ClFN3O — CID 174487943
3-[(2-chloro-4-fluorophenyl)methoxy]-5-[4-(pyrrolidin-1-ylmethyl)phenyl]pyridin-2-amine (PubChem CID 174487943) has the molecular formula C23H23ClFN3O and a molecular weight of 411.91 g/mol. Its IUPAC name is 3-[(2-chloro-4-fluorophenyl)methoxy]-5-[4-(pyrrolidin-1-ylmethyl)phenyl]pyridin-2-amine.
| Compound Name | 3-[(2-chloro-4-fluorophenyl)methoxy]-5-[4-(pyrrolidin-1-ylmethyl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 174487943 |
| Molecular Formula | C23H23ClFN3O |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 3-[(2-chloro-4-fluorophenyl)methoxy]-5-[4-(pyrrolidin-1-ylmethyl)phenyl]pyridin-2-amine |
| SMILES | Nc1ncc(-c2ccc(CN3CCCC3)cc2)cc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C23H23ClFN3O/c24-21-12-20(25)8-7-18(21)15-29-22-11-19(13-27-23(22)26)17-5-3-16(4-6-17)14-28-9-1-2-10-28/h3-8,11-13H,1-2,9-10,14-15H2,(H2,26,27) |
| InChIKey | AXFOIPSFERIWHU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|