C12H9BClFN2O — CID 89393220
CID 89393220 (PubChem CID 89393220) has the molecular formula C12H9BClFN2O and a molecular weight of 262.48 g/mol.
| Compound Name | CID 89393220 |
|---|---|
| PubChem CID | 89393220 |
| Molecular Formula | C12H9BClFN2O |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(N)c(OCc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C12H9BClFN2O/c13-8-3-11(12(16)17-5-8)18-6-7-1-2-9(15)4-10(7)14/h1-5H,6H2,(H2,16,17) |
| InChIKey | SGJVXUYDCIKQAY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|