C15H13N3S — CID 142938168
5-methyl-3-(4-methylphenyl)-4-pyrimidin-4-yl-1,2-thiazole (PubChem CID 142938168) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is 5-methyl-3-(4-methylphenyl)-4-pyrimidin-4-yl-1,2-thiazole.
| Compound Name | 5-methyl-3-(4-methylphenyl)-4-pyrimidin-4-yl-1,2-thiazole |
|---|---|
| PubChem CID | 142938168 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 5-methyl-3-(4-methylphenyl)-4-pyrimidin-4-yl-1,2-thiazole |
| SMILES | Cc1ccc(-c2nsc(C)c2-c2ccncn2)cc1 |
| InChI | InChI=1S/C15H13N3S/c1-10-3-5-12(6-4-10)15-14(11(2)19-18-15)13-7-8-16-9-17-13/h3-9H,1-2H3 |
| InChIKey | AAFAJTFQLLCGIB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |