C12H13NO2S — CID 142938237
6-(hydroxy-methylidene-oxo-λ6-sulfanyl)-2-methylnaphthalen-1-amine (PubChem CID 142938237) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 6-(hydroxy-methylidene-oxo-λ6-sulfanyl)-2-methylnaphthalen-1-amine.
| Compound Name | 6-(hydroxy-methylidene-oxo-λ6-sulfanyl)-2-methylnaphthalen-1-amine |
|---|---|
| PubChem CID | 142938237 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 6-(hydroxy-methylidene-oxo-λ6-sulfanyl)-2-methylnaphthalen-1-amine |
| SMILES | C=S(=O)(O)c1ccc2c(N)c(C)ccc2c1 |
| InChI | InChI=1S/C12H13NO2S/c1-8-3-4-9-7-10(16(2,14)15)5-6-11(9)12(8)13/h3-7H,2,13H2,1H3,(H,14,15) |
| InChIKey | VSSCUVHAACMQAU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|