C14H14O7S2 — CID 143443540
7-(hydroxy-methylidene-oxo-λ6-sulfanyl)-4-(2-oxopropoxy)naphthalene-2-sulfonic acid (PubChem CID 143443540) has the molecular formula C14H14O7S2 and a molecular weight of 358.39 g/mol. Its IUPAC name is 7-(hydroxy-methylidene-oxo-λ6-sulfanyl)-4-(2-oxopropoxy)naphthalene-2-sulfonic acid.
| Compound Name | 7-(hydroxy-methylidene-oxo-λ6-sulfanyl)-4-(2-oxopropoxy)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 143443540 |
| Molecular Formula | C14H14O7S2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 7-(hydroxy-methylidene-oxo-λ6-sulfanyl)-4-(2-oxopropoxy)naphthalene-2-sulfonic acid |
| SMILES | C=S(=O)(O)c1ccc2c(OCC(C)=O)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C14H14O7S2/c1-9(15)8-21-14-7-12(23(18,19)20)6-10-5-11(22(2,16)17)3-4-13(10)14/h3-7H,2,8H2,1H3,(H,16,17)(H,18,19,20) |
| InChIKey | QRLWFWCXYUMEDU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|