C14H13NO7S2 — CID 57281712
7-amino-4-(3-methylsulfonylprop-2-enoyloxy)naphthalene-2-sulfonic acid (PubChem CID 57281712) has the molecular formula C14H13NO7S2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 7-amino-4-(3-methylsulfonylprop-2-enoyloxy)naphthalene-2-sulfonic acid.
| Compound Name | 7-amino-4-(3-methylsulfonylprop-2-enoyloxy)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 57281712 |
| Molecular Formula | C14H13NO7S2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 7-amino-4-(3-methylsulfonylprop-2-enoyloxy)naphthalene-2-sulfonic acid |
| SMILES | CS(=O)(=O)C=CC(=O)Oc1cc(S(=O)(=O)O)cc2cc(N)ccc12 |
| InChI | InChI=1S/C14H13NO7S2/c1-23(17,18)5-4-14(16)22-13-8-11(24(19,20)21)7-9-6-10(15)2-3-12(9)13/h2-8H,15H2,1H3,(H,19,20,21) |
| InChIKey | YSZMHXGUBKMMQV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|