C19H23FO4S — CID 142940062
2-[4-fluoro-2-methoxy-5-[(5-methylthiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 142940062) has the molecular formula C19H23FO4S and a molecular weight of 366.45 g/mol. Its IUPAC name is 2-[4-fluoro-2-methoxy-5-[(5-methylthiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[4-fluoro-2-methoxy-5-[(5-methylthiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 142940062 |
| Molecular Formula | C19H23FO4S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[4-fluoro-2-methoxy-5-[(5-methylthiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | COc1cc(F)c(Cc2ccc(C)s2)cc1C1CC(O)CC(CO)O1 |
| InChI | InChI=1S/C19H23FO4S/c1-11-3-4-15(25-11)5-12-6-16(18(23-2)9-17(12)20)19-8-13(22)7-14(10-21)24-19/h3-4,6,9,13-14,19,21-22H,5,7-8,10H2,1-2H3 |
| InChIKey | DKKBPHPXHJEYKU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |