About CID 142940078
CID 142940078 (PubChem CID 142940078) has the molecular formula C10H9OSn
and a molecular weight of 263.89 g/mol.
Molecular Properties
| Compound Name | CID 142940078 |
| PubChem CID | 142940078 |
| Molecular Formula | C10H9OSn |
| Molecular Weight | 263.89 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | — |
| SMILES | Cc1ccc2cc([Sn])oc2c1C |
| InChI | InChI=1S/C10H9O.Sn/c1-7-3-4-9-5-6-11-10(9)8(7)2;/h3-5H,1-2H3; |
| InChIKey | KBNZAMHLICPFSC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.89 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 142940078 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142940078?
The IUPAC name of CID 142940078 (CID 142940078) is not available.
What is the SMILES notation for CID 142940078?
The canonical SMILES for CID 142940078 is Cc1ccc2cc([Sn])oc2c1C.
What is the InChIKey of CID 142940078?
The InChIKey is KBNZAMHLICPFSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9O.Sn/c1-7-3-4-9-5-6-11-10(9)8(7)2;/h3-5H,1-2H3;.
What are the key properties of CID 142940078?
CID 142940078 has a molecular weight of 263.89 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142940078 is sourced from PubChem (CID 142940078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).