About N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene
N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene (PubChem CID 142940150) has the molecular formula C14H20FN
and a molecular weight of 221.32 g/mol. Its IUPAC name is N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene |
| PubChem CID | 142940150 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene |
| SMILES | C=CCNCC1CC1.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C7H7F.C7H13N/c1-6-2-4-7(8)5-3-6;1-2-5-8-6-7-3-4-7/h2-5H,1H3;2,7-8H,1,3-6H2 |
| InChIKey | PFKBFFQNPVXEQY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene?
The IUPAC name of N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene (CID 142940150) is N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene.
What is the SMILES notation for N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene?
The canonical SMILES for N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene is C=CCNCC1CC1.Cc1ccc(F)cc1.
What is the InChIKey of N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene?
The InChIKey is PFKBFFQNPVXEQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C7H13N/c1-6-2-4-7(8)5-3-6;1-2-5-8-6-7-3-4-7/h2-5H,1H3;2,7-8H,1,3-6H2.
What are the key properties of N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene?
N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene has a molecular weight of 221.32 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)prop-2-en-1-amine;1-fluoro-4-methylbenzene is sourced from PubChem (CID 142940150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).