C24H25FN6O — CID 142940524
2-amino-N-[4-(2,3-dimethylpyrrol-1-yl)-2-(2-fluorophenyl)quinazolin-6-yl]acetamide;N-methylmethanimine (PubChem CID 142940524) has the molecular formula C24H25FN6O and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-amino-N-[4-(2,3-dimethylpyrrol-1-yl)-2-(2-fluorophenyl)quinazolin-6-yl]acetamide;N-methylmethanimine.
| Compound Name | 2-amino-N-[4-(2,3-dimethylpyrrol-1-yl)-2-(2-fluorophenyl)quinazolin-6-yl]acetamide;N-methylmethanimine |
|---|---|
| PubChem CID | 142940524 |
| Molecular Formula | C24H25FN6O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 2-amino-N-[4-(2,3-dimethylpyrrol-1-yl)-2-(2-fluorophenyl)quinazolin-6-yl]acetamide;N-methylmethanimine |
| SMILES | C=NC.Cc1ccn(-c2nc(-c3ccccc3F)nc3ccc(NC(=O)CN)cc23)c1C |
| InChI | InChI=1S/C22H20FN5O.C2H5N/c1-13-9-10-28(14(13)2)22-17-11-15(25-20(29)12-24)7-8-19(17)26-21(27-22)16-5-3-4-6-18(16)23;1-3-2/h3-11H,12,24H2,1-2H3,(H,25,29);1H2,2H3 |
| InChIKey | GZLRFSWIBPQPDS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|