C22H23FN4O3 — CID 155589240
3-(2-fluorophenyl)-6-(2-hydroxybutylcarbamoylamino)-2-methylquinoline-4-carboxamide (PubChem CID 155589240) has the molecular formula C22H23FN4O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-6-(2-hydroxybutylcarbamoylamino)-2-methylquinoline-4-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-6-(2-hydroxybutylcarbamoylamino)-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 155589240 |
| Molecular Formula | C22H23FN4O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-(2-fluorophenyl)-6-(2-hydroxybutylcarbamoylamino)-2-methylquinoline-4-carboxamide |
| SMILES | CCC(O)CNC(=O)Nc1ccc2nc(C)c(-c3ccccc3F)c(C(N)=O)c2c1 |
| InChI | InChI=1S/C22H23FN4O3/c1-3-14(28)11-25-22(30)27-13-8-9-18-16(10-13)20(21(24)29)19(12(2)26-18)15-6-4-5-7-17(15)23/h4-10,14,28H,3,11H2,1-2H3,(H2,24,29)(H2,25,27,30) |
| InChIKey | KUTYLYKANLSKCZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |