C26H23F2N3O2 — CID 155589258
1-[3-(2-fluorophenyl)-2-(4-fluorophenyl)quinolin-6-yl]-3-(2-hydroxybutyl)urea (PubChem CID 155589258) has the molecular formula C26H23F2N3O2 and a molecular weight of 447.49 g/mol. Its IUPAC name is 1-[3-(2-fluorophenyl)-2-(4-fluorophenyl)quinolin-6-yl]-3-(2-hydroxybutyl)urea.
| Compound Name | 1-[3-(2-fluorophenyl)-2-(4-fluorophenyl)quinolin-6-yl]-3-(2-hydroxybutyl)urea |
|---|---|
| PubChem CID | 155589258 |
| Molecular Formula | C26H23F2N3O2 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 1-[3-(2-fluorophenyl)-2-(4-fluorophenyl)quinolin-6-yl]-3-(2-hydroxybutyl)urea |
| SMILES | CCC(O)CNC(=O)Nc1ccc2nc(-c3ccc(F)cc3)c(-c3ccccc3F)cc2c1 |
| InChI | InChI=1S/C26H23F2N3O2/c1-2-20(32)15-29-26(33)30-19-11-12-24-17(13-19)14-22(21-5-3-4-6-23(21)28)25(31-24)16-7-9-18(27)10-8-16/h3-14,20,32H,2,15H2,1H3,(H2,29,30,33) |
| InChIKey | FTHMIYFUWWXOIS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |