C21H22FN3O — CID 155589229
1-butyl-3-[3-(2-fluorophenyl)-2-methylquinolin-6-yl]urea (PubChem CID 155589229) has the molecular formula C21H22FN3O and a molecular weight of 351.43 g/mol. Its IUPAC name is 1-butyl-3-[3-(2-fluorophenyl)-2-methylquinolin-6-yl]urea.
| Compound Name | 1-butyl-3-[3-(2-fluorophenyl)-2-methylquinolin-6-yl]urea |
|---|---|
| PubChem CID | 155589229 |
| Molecular Formula | C21H22FN3O |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-butyl-3-[3-(2-fluorophenyl)-2-methylquinolin-6-yl]urea |
| SMILES | CCCCNC(=O)Nc1ccc2nc(C)c(-c3ccccc3F)cc2c1 |
| InChI | InChI=1S/C21H22FN3O/c1-3-4-11-23-21(26)25-16-9-10-20-15(12-16)13-18(14(2)24-20)17-7-5-6-8-19(17)22/h5-10,12-13H,3-4,11H2,1-2H3,(H2,23,25,26) |
| InChIKey | HOJBLEQCZDYVCH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|