About 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea
1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea (PubChem CID 155589318) has the molecular formula C24H23N5O4
and a molecular weight of 445.48 g/mol. Its IUPAC name is 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea.
Molecular Properties
| Compound Name | 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea |
| PubChem CID | 155589318 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea |
| SMILES | CCC(O)CNC(=O)Nc1ccc2nc(-c3cc[nH]c(=O)c3)c(-c3cc[nH]c(=O)c3)cc2c1 |
| InChI | InChI=1S/C24H23N5O4/c1-2-18(30)13-27-24(33)28-17-3-4-20-16(9-17)10-19(14-5-7-25-21(31)11-14)23(29-20)15-6-8-26-22(32)12-15/h3-12,18,30H,2,13H2,1H3,(H,25,31)(H,26,32)(H2,27,28,33) |
| InChIKey | GMUPNJMAHRQUTJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 139.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea?
The IUPAC name of 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea (CID 155589318) is 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea.
What is the SMILES notation for 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea?
The canonical SMILES for 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea is CCC(O)CNC(=O)Nc1ccc2nc(-c3cc[nH]c(=O)c3)c(-c3cc[nH]c(=O)c3)cc2c1.
What is the InChIKey of 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea?
The InChIKey is GMUPNJMAHRQUTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N5O4/c1-2-18(30)13-27-24(33)28-17-3-4-20-16(9-17)10-19(14-5-7-25-21(31)11-14)23(29-20)15-6-8-26-22(32)12-15/h3-12,18,30H,2,13H2,1H3,(H,25,31)(H,26,32)(H2,27,28,33).
What are the key properties of 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea?
1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea has a molecular weight of 445.48 g/mol, XLogP of 2.84, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea is sourced from PubChem (CID 155589318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).