C24H23N5O4 — CID 155589318
1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea (PubChem CID 155589318) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea.
| Compound Name | 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea |
|---|---|
| PubChem CID | 155589318 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 1-[2,3-bis(2-oxo-1H-pyridin-4-yl)quinolin-6-yl]-3-(2-hydroxybutyl)urea |
| SMILES | CCC(O)CNC(=O)Nc1ccc2nc(-c3cc[nH]c(=O)c3)c(-c3cc[nH]c(=O)c3)cc2c1 |
| InChI | InChI=1S/C24H23N5O4/c1-2-18(30)13-27-24(33)28-17-3-4-20-16(9-17)10-19(14-5-7-25-21(31)11-14)23(29-20)15-6-8-26-22(32)12-15/h3-12,18,30H,2,13H2,1H3,(H,25,31)(H,26,32)(H2,27,28,33) |
| InChIKey | GMUPNJMAHRQUTJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 139.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |