C28H27NO2 — CID 167696611
1-(2,3-diphenylquinolin-6-yl)-5-hydroxyheptan-2-one (PubChem CID 167696611) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-(2,3-diphenylquinolin-6-yl)-5-hydroxyheptan-2-one.
| Compound Name | 1-(2,3-diphenylquinolin-6-yl)-5-hydroxyheptan-2-one |
|---|---|
| PubChem CID | 167696611 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-(2,3-diphenylquinolin-6-yl)-5-hydroxyheptan-2-one |
| SMILES | CCC(O)CCC(=O)Cc1ccc2nc(-c3ccccc3)c(-c3ccccc3)cc2c1 |
| InChI | InChI=1S/C28H27NO2/c1-2-24(30)14-15-25(31)18-20-13-16-27-23(17-20)19-26(21-9-5-3-6-10-21)28(29-27)22-11-7-4-8-12-22/h3-13,16-17,19,24,30H,2,14-15,18H2,1H3 |
| InChIKey | XTDZISSTIBGYGG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |