C26H29NO3 — CID 167685594
(5R)-5-hydroxy-1-(3-methyl-2-phenyl-4-propanoylquinolin-6-yl)heptan-2-one (PubChem CID 167685594) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is (5R)-5-hydroxy-1-(3-methyl-2-phenyl-4-propanoylquinolin-6-yl)heptan-2-one.
| Compound Name | (5R)-5-hydroxy-1-(3-methyl-2-phenyl-4-propanoylquinolin-6-yl)heptan-2-one |
|---|---|
| PubChem CID | 167685594 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (5R)-5-hydroxy-1-(3-methyl-2-phenyl-4-propanoylquinolin-6-yl)heptan-2-one |
| SMILES | CCC(=O)c1c(C)c(-c2ccccc2)nc2ccc(CC(=O)CC[C@H](O)CC)cc12 |
| InChI | InChI=1S/C26H29NO3/c1-4-20(28)12-13-21(29)15-18-11-14-23-22(16-18)25(24(30)5-2)17(3)26(27-23)19-9-7-6-8-10-19/h6-11,14,16,20,28H,4-5,12-13,15H2,1-3H3/t20-/m1/s1 |
| InChIKey | WDYMRNHCAXMXOA-HXUWFJFHSA-N |
| XLogP | 5.47 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |