C28H25F2NO — CID 167693810
1-(2,3-diphenylquinolin-6-yl)-5,5-difluoroheptan-2-one (PubChem CID 167693810) has the molecular formula C28H25F2NO and a molecular weight of 429.51 g/mol. Its IUPAC name is 1-(2,3-diphenylquinolin-6-yl)-5,5-difluoroheptan-2-one.
| Compound Name | 1-(2,3-diphenylquinolin-6-yl)-5,5-difluoroheptan-2-one |
|---|---|
| PubChem CID | 167693810 |
| Molecular Formula | C28H25F2NO |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-(2,3-diphenylquinolin-6-yl)-5,5-difluoroheptan-2-one |
| SMILES | CCC(F)(F)CCC(=O)Cc1ccc2nc(-c3ccccc3)c(-c3ccccc3)cc2c1 |
| InChI | InChI=1S/C28H25F2NO/c1-2-28(29,30)16-15-24(32)18-20-13-14-26-23(17-20)19-25(21-9-5-3-6-10-21)27(31-26)22-11-7-4-8-12-22/h3-14,17,19H,2,15-16,18H2,1H3 |
| InChIKey | XIRIKLLTHYBWKP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |