C36H44IrNO2Si- — CID 156675957
[2-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-3-phenylquinolin-6-yl]-trimethylsilane;(Z)-5-hydroxyhept-4-en-3-one;iridium (PubChem CID 156675957) has the molecular formula C36H44IrNO2Si- and a molecular weight of 743.06 g/mol. Its IUPAC name is [2-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-3-phenylquinolin-6-yl]-trimethylsilane;(Z)-5-hydroxyhept-4-en-3-one;iridium.
| Compound Name | [2-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-3-phenylquinolin-6-yl]-trimethylsilane;(Z)-5-hydroxyhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 156675957 |
| Molecular Formula | C36H44IrNO2Si- |
| Molecular Weight | 743.06 g/mol |
| Exact Mass | 743.28 |
| IUPAC Name | [2-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-3-phenylquinolin-6-yl]-trimethylsilane;(Z)-5-hydroxyhept-4-en-3-one;iridium |
| SMILES | CCC(=O)/C=C(\O)CC.Cc1[c-]c(-c2nc3ccc([Si](C)(C)C)cc3cc2-c2ccccc2)cc(C(C)(C)C)c1.[Ir] |
| InChI | InChI=1S/C29H32NSi.C7H12O2.Ir/c1-20-15-23(17-24(16-20)29(2,3)4)28-26(21-11-9-8-10-12-21)19-22-18-25(31(5,6)7)13-14-27(22)30-28;1-3-6(8)5-7(9)4-2;/h8-14,16-19H,1-7H3;5,8H,3-4H2,1-2H3;/q-1;;/b;6-5-; |
| InChIKey | YCCBAWOPRTULRJ-XRPAZMCKSA-N |
| XLogP | 9.34 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.06 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|