C23H23F2NO — CID 167595176
5,5-difluoro-1-(2-methyl-3-phenylquinolin-6-yl)heptan-2-one (PubChem CID 167595176) has the molecular formula C23H23F2NO and a molecular weight of 367.44 g/mol. Its IUPAC name is 5,5-difluoro-1-(2-methyl-3-phenylquinolin-6-yl)heptan-2-one.
| Compound Name | 5,5-difluoro-1-(2-methyl-3-phenylquinolin-6-yl)heptan-2-one |
|---|---|
| PubChem CID | 167595176 |
| Molecular Formula | C23H23F2NO |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 5,5-difluoro-1-(2-methyl-3-phenylquinolin-6-yl)heptan-2-one |
| SMILES | CCC(F)(F)CCC(=O)Cc1ccc2nc(C)c(-c3ccccc3)cc2c1 |
| InChI | InChI=1S/C23H23F2NO/c1-3-23(24,25)12-11-20(27)14-17-9-10-22-19(13-17)15-21(16(2)26-22)18-7-5-4-6-8-18/h4-10,13,15H,3,11-12,14H2,1-2H3 |
| InChIKey | IYWAPITWZRIROK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |