C29H29FN2O4 — CID 142942110
8-fluoro-4-oxo-N-[2-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]ethyl]chromene-2-carboxamide (PubChem CID 142942110) has the molecular formula C29H29FN2O4 and a molecular weight of 488.56 g/mol. Its IUPAC name is 8-fluoro-4-oxo-N-[2-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]ethyl]chromene-2-carboxamide.
| Compound Name | 8-fluoro-4-oxo-N-[2-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]ethyl]chromene-2-carboxamide |
|---|---|
| PubChem CID | 142942110 |
| Molecular Formula | C29H29FN2O4 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 8-fluoro-4-oxo-N-[2-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]ethyl]chromene-2-carboxamide |
| SMILES | O=C(NCC=C1CCC(c2ccccc2CN2CCCC2=O)CC1)c1cc(=O)c2cccc(F)c2o1 |
| InChI | InChI=1S/C29H29FN2O4/c30-24-8-3-7-23-25(33)17-26(36-28(23)24)29(35)31-15-14-19-10-12-20(13-11-19)22-6-2-1-5-21(22)18-32-16-4-9-27(32)34/h1-3,5-8,14,17,20H,4,9-13,15-16,18H2,(H,31,35)/b19-14- |
| InChIKey | UFXNDZLHDUPNBL-RGEXLXHISA-N |
| XLogP | 5.07 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|