C37H37ClN2O6 — CID 58917493
N-[(2R)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide (PubChem CID 58917493) has the molecular formula C37H37ClN2O6 and a molecular weight of 641.16 g/mol. Its IUPAC name is N-[(2R)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[(2R)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 58917493 |
| Molecular Formula | C37H37ClN2O6 |
| Molecular Weight | 641.16 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | N-[(2R)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide |
| SMILES | O=C(N[C@@H](C=C1CCC(c2ccccc2CN2CCCCC2=O)CC1)Cc1ccc(Cl)cc1)c1cc(=O)c2cc(O)c(O)cc2o1 |
| InChI | InChI=1S/C37H37ClN2O6/c38-27-14-10-24(11-15-27)18-28(39-37(45)35-20-31(41)30-19-32(42)33(43)21-34(30)46-35)17-23-8-12-25(13-9-23)29-6-2-1-5-26(29)22-40-16-4-3-7-36(40)44/h1-2,5-6,10-11,14-15,17,19-21,25,28,42-43H,3-4,7-9,12-13,16,18,22H2,(H,39,45)/b23-17-/t25?,28-/m0/s1 |
| InChIKey | FNSVUSHUVVJXCK-ZIHMOPEZSA-N |
| XLogP | 7.00 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.16 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|