C36H36ClN3O6 — CID 58917368
N-[(2R)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide (PubChem CID 58917368) has the molecular formula C36H36ClN3O6 and a molecular weight of 642.15 g/mol. Its IUPAC name is N-[(2R)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[(2R)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 58917368 |
| Molecular Formula | C36H36ClN3O6 |
| Molecular Weight | 642.15 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | N-[(2R)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide |
| SMILES | O=C(N[C@@H](C=C1CCN(c2ccccc2CN2CCCCC2=O)CC1)Cc1ccc(Cl)cc1)c1cc(=O)c2cc(O)c(O)cc2o1 |
| InChI | InChI=1S/C36H36ClN3O6/c37-26-10-8-23(9-11-26)17-27(38-36(45)34-20-30(41)28-19-31(42)32(43)21-33(28)46-34)18-24-12-15-39(16-13-24)29-6-2-1-5-25(29)22-40-14-4-3-7-35(40)44/h1-2,5-6,8-11,18-21,27,42-43H,3-4,7,12-17,22H2,(H,38,45)/t27-/m1/s1 |
| InChIKey | LDSQSQUEWVXODU-HHHXNRCGSA-N |
| XLogP | 5.94 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.15 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|