C35H34ClN3O6 — CID 58917741
N-[(2S)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide (PubChem CID 58917741) has the molecular formula C35H34ClN3O6 and a molecular weight of 628.13 g/mol. Its IUPAC name is N-[(2S)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[(2S)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 58917741 |
| Molecular Formula | C35H34ClN3O6 |
| Molecular Weight | 628.13 g/mol |
| Exact Mass | 627.21 |
| IUPAC Name | N-[(2S)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide |
| SMILES | O=C(N[C@H](C=C1CCN(c2ccccc2CN2CCCC2=O)CC1)Cc1ccc(Cl)cc1)c1cc(=O)c2cc(O)c(O)cc2o1 |
| InChI | InChI=1S/C35H34ClN3O6/c36-25-9-7-22(8-10-25)16-26(37-35(44)33-19-29(40)27-18-30(41)31(42)20-32(27)45-33)17-23-11-14-38(15-12-23)28-5-2-1-4-24(28)21-39-13-3-6-34(39)43/h1-2,4-5,7-10,17-20,26,41-42H,3,6,11-16,21H2,(H,37,44)/t26-/m0/s1 |
| InChIKey | WONMZRSEXYYQGX-SANMLTNESA-N |
| XLogP | 5.55 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.13 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|