C35H35ClN4O7 — CID 58768257
N-[(2R)-3-(4-chlorophenyl)-1-oxo-1-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperazin-1-yl]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide (PubChem CID 58768257) has the molecular formula C35H35ClN4O7 and a molecular weight of 659.14 g/mol. Its IUPAC name is N-[(2R)-3-(4-chlorophenyl)-1-oxo-1-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperazin-1-yl]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[(2R)-3-(4-chlorophenyl)-1-oxo-1-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperazin-1-yl]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 58768257 |
| Molecular Formula | C35H35ClN4O7 |
| Molecular Weight | 659.14 g/mol |
| Exact Mass | 658.22 |
| IUPAC Name | N-[(2R)-3-(4-chlorophenyl)-1-oxo-1-[4-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperazin-1-yl]propan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide |
| SMILES | O=C(N[C@H](Cc1ccc(Cl)cc1)C(=O)N1CCN(c2ccccc2CN2CCCCC2=O)CC1)c1cc(=O)c2cc(O)c(O)cc2o1 |
| InChI | InChI=1S/C35H35ClN4O7/c36-24-10-8-22(9-11-24)17-26(37-34(45)32-19-28(41)25-18-29(42)30(43)20-31(25)47-32)35(46)39-15-13-38(14-16-39)27-6-2-1-5-23(27)21-40-12-4-3-7-33(40)44/h1-2,5-6,8-11,18-20,26,42-43H,3-4,7,12-17,21H2,(H,37,45)/t26-/m1/s1 |
| InChIKey | IPFKWBDHOWRNCG-AREMUKBSSA-N |
| XLogP | 4.06 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.14 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|