C30H32N2O5 — CID 142942105
7-methoxy-4-oxo-N-[2-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]ethyl]chromene-2-carboxamide (PubChem CID 142942105) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 7-methoxy-4-oxo-N-[2-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]ethyl]chromene-2-carboxamide.
| Compound Name | 7-methoxy-4-oxo-N-[2-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]ethyl]chromene-2-carboxamide |
|---|---|
| PubChem CID | 142942105 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 7-methoxy-4-oxo-N-[2-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]ethyl]chromene-2-carboxamide |
| SMILES | COc1ccc2c(=O)cc(C(=O)NCC=C3CCC(c4ccccc4CN4CCCC4=O)CC3)oc2c1 |
| InChI | InChI=1S/C30H32N2O5/c1-36-23-12-13-25-26(33)18-28(37-27(25)17-23)30(35)31-15-14-20-8-10-21(11-9-20)24-6-3-2-5-22(24)19-32-16-4-7-29(32)34/h2-3,5-6,12-14,17-18,21H,4,7-11,15-16,19H2,1H3,(H,31,35)/b20-14- |
| InChIKey | RCBSUGGHTNXXTD-ZHZULCJRSA-N |
| XLogP | 4.94 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|