C38H34ClF5N2O5 — CID 58917393
N-[(2R)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide (PubChem CID 58917393) has the molecular formula C38H34ClF5N2O5 and a molecular weight of 729.14 g/mol. Its IUPAC name is N-[(2R)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide.
| Compound Name | N-[(2R)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide |
|---|---|
| PubChem CID | 58917393 |
| Molecular Formula | C38H34ClF5N2O5 |
| Molecular Weight | 729.14 g/mol |
| Exact Mass | 728.21 |
| IUPAC Name | N-[(2R)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide |
| SMILES | O=C(N[C@@H](C=C1CCC(c2ccccc2CN2CCCC2=O)CC1)Cc1ccc(Cl)cc1)c1cc(=O)c2cc(OC(F)(F)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C38H34ClF5N2O5/c39-27-13-9-24(10-14-27)19-28(18-23-7-11-25(12-8-23)30-5-2-1-4-26(30)22-46-17-3-6-35(46)48)45-36(49)34-21-32(47)31-20-29(15-16-33(31)50-34)51-38(43,44)37(40,41)42/h1-2,4-5,9-10,13-16,18,20-21,25,28H,3,6-8,11-12,17,19,22H2,(H,45,49)/b23-18-/t25?,28-/m0/s1 |
| InChIKey | XBASOBUSNGBYRW-FAGHZKDNSA-N |
| XLogP | 8.73 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.14 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|