C7H14N2O — CID 142943855
ethane;4-methyl-1,2-dihydropyrazin-3-one (PubChem CID 142943855) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is ethane;4-methyl-1,2-dihydropyrazin-3-one.
| Compound Name | ethane;4-methyl-1,2-dihydropyrazin-3-one |
|---|---|
| PubChem CID | 142943855 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | ethane;4-methyl-1,2-dihydropyrazin-3-one |
| SMILES | CC.CN1C=CNCC1=O |
| InChI | InChI=1S/C5H8N2O.C2H6/c1-7-3-2-6-4-5(7)8;1-2/h2-3,6H,4H2,1H3;1-2H3 |
| InChIKey | BJEUTDCRABVVQT-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |