C8H11N — CID 142944109
2,3-dimethyl-4H-azepine (PubChem CID 142944109) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 2,3-dimethyl-4H-azepine.
| Compound Name | 2,3-dimethyl-4H-azepine |
|---|---|
| PubChem CID | 142944109 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 2,3-dimethyl-4H-azepine |
| SMILES | CC1=C(C)N=CC=CC1 |
| InChI | InChI=1S/C8H11N/c1-7-5-3-4-6-9-8(7)2/h3-4,6H,5H2,1-2H3 |
| InChIKey | OPCWMHHOIFWJKW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |