C12H20F3N — CID 176967353
ethane;N-[(E)-3-(trifluoromethyl)hex-2-en-2-yl]prop-2-en-1-imine (PubChem CID 176967353) has the molecular formula C12H20F3N and a molecular weight of 235.29 g/mol. Its IUPAC name is ethane;N-[(E)-3-(trifluoromethyl)hex-2-en-2-yl]prop-2-en-1-imine.
| Compound Name | ethane;N-[(E)-3-(trifluoromethyl)hex-2-en-2-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 176967353 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | ethane;N-[(E)-3-(trifluoromethyl)hex-2-en-2-yl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C(C)=C(\CCC)C(F)(F)F.CC |
| InChI | InChI=1S/C10H14F3N.C2H6/c1-4-6-9(10(11,12)13)8(3)14-7-5-2;1-2/h5,7H,2,4,6H2,1,3H3;1-2H3/b9-8+,14-7+; |
| InChIKey | BZUCCTPMGVAAEM-DKLYTDOWSA-N |
| XLogP | 4.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|