C15H18N2O2 — CID 142944398
N,1-dimethyl-4-(3-methylphenoxy)-2H-pyridine-2-carboxamide (PubChem CID 142944398) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N,1-dimethyl-4-(3-methylphenoxy)-2H-pyridine-2-carboxamide.
| Compound Name | N,1-dimethyl-4-(3-methylphenoxy)-2H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142944398 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N,1-dimethyl-4-(3-methylphenoxy)-2H-pyridine-2-carboxamide |
| SMILES | CNC(=O)C1C=C(Oc2cccc(C)c2)C=CN1C |
| InChI | InChI=1S/C15H18N2O2/c1-11-5-4-6-12(9-11)19-13-7-8-17(3)14(10-13)15(18)16-2/h4-10,14H,1-3H3,(H,16,18) |
| InChIKey | VEXBICPNSAZHBQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |