C23H24F2N3O3P — CID 142944409
N'-[3-[difluoro(phosphanyl)methyl]-4-methylphenyl]-N-(3-pyridin-4-yloxyphenyl)oxamide;ethane (PubChem CID 142944409) has the molecular formula C23H24F2N3O3P and a molecular weight of 459.43 g/mol. Its IUPAC name is N'-[3-[difluoro(phosphanyl)methyl]-4-methylphenyl]-N-(3-pyridin-4-yloxyphenyl)oxamide;ethane.
| Compound Name | N'-[3-[difluoro(phosphanyl)methyl]-4-methylphenyl]-N-(3-pyridin-4-yloxyphenyl)oxamide;ethane |
|---|---|
| PubChem CID | 142944409 |
| Molecular Formula | C23H24F2N3O3P |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | N'-[3-[difluoro(phosphanyl)methyl]-4-methylphenyl]-N-(3-pyridin-4-yloxyphenyl)oxamide;ethane |
| SMILES | CC.Cc1ccc(NC(=O)C(=O)Nc2cccc(Oc3ccncc3)c2)cc1C(F)(F)P |
| InChI | InChI=1S/C21H18F2N3O3P.C2H6/c1-13-5-6-15(12-18(13)21(22,23)30)26-20(28)19(27)25-14-3-2-4-17(11-14)29-16-7-9-24-10-8-16;1-2/h2-12H,30H2,1H3,(H,25,27)(H,26,28);1-2H3 |
| InChIKey | YDTWPGJNQBAUJX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|