C20H20N4O2 — CID 11428013
1-(3,4-dimethylphenyl)-3-(3-pyridin-4-yloxyanilino)urea (PubChem CID 11428013) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(3-pyridin-4-yloxyanilino)urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(3-pyridin-4-yloxyanilino)urea |
|---|---|
| PubChem CID | 11428013 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(3-pyridin-4-yloxyanilino)urea |
| SMILES | Cc1ccc(NC(=O)NNc2cccc(Oc3ccncc3)c2)cc1C |
| InChI | InChI=1S/C20H20N4O2/c1-14-6-7-16(12-15(14)2)22-20(25)24-23-17-4-3-5-19(13-17)26-18-8-10-21-11-9-18/h3-13,23H,1-2H3,(H2,22,24,25) |
| InChIKey | NKHPEFDBANSKMJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|