C20H28N2O2 — CID 142945446
benzyl 4-[(3E,5Z)-hepta-3,5-dien-3-yl]-1,4-diazepane-1-carboxylate (PubChem CID 142945446) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is benzyl 4-[(3E,5Z)-hepta-3,5-dien-3-yl]-1,4-diazepane-1-carboxylate.
| Compound Name | benzyl 4-[(3E,5Z)-hepta-3,5-dien-3-yl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 142945446 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | benzyl 4-[(3E,5Z)-hepta-3,5-dien-3-yl]-1,4-diazepane-1-carboxylate |
| SMILES | C/C=C\C=C(/CC)N1CCCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H28N2O2/c1-3-5-12-19(4-2)21-13-9-14-22(16-15-21)20(23)24-17-18-10-7-6-8-11-18/h3,5-8,10-12H,4,9,13-17H2,1-2H3/b5-3-,19-12+ |
| InChIKey | OMOLLNUARRHDML-JIYMZONUSA-N |
| XLogP | 4.20 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|