About 3-methyl-3,4-dihydropyridin-4-amine
3-methyl-3,4-dihydropyridin-4-amine (PubChem CID 142948382) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 3-methyl-3,4-dihydropyridin-4-amine.
Molecular Properties
| Compound Name | 3-methyl-3,4-dihydropyridin-4-amine |
| PubChem CID | 142948382 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 3-methyl-3,4-dihydropyridin-4-amine |
| SMILES | CC1C=NC=CC1N |
| InChI | InChI=1S/C6H10N2/c1-5-4-8-3-2-6(5)7/h2-6H,7H2,1H3 |
| InChIKey | PCORXKURSFFZLV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-3,4-dihydropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3,4-dihydropyridin-4-amine?
The IUPAC name of 3-methyl-3,4-dihydropyridin-4-amine (CID 142948382) is 3-methyl-3,4-dihydropyridin-4-amine.
What is the SMILES notation for 3-methyl-3,4-dihydropyridin-4-amine?
The canonical SMILES for 3-methyl-3,4-dihydropyridin-4-amine is CC1C=NC=CC1N.
What is the InChIKey of 3-methyl-3,4-dihydropyridin-4-amine?
The InChIKey is PCORXKURSFFZLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-5-4-8-3-2-6(5)7/h2-6H,7H2,1H3.
What are the key properties of 3-methyl-3,4-dihydropyridin-4-amine?
3-methyl-3,4-dihydropyridin-4-amine has a molecular weight of 110.16 g/mol, XLogP of 0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3,4-dihydropyridin-4-amine is sourced from PubChem (CID 142948382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).