About (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine
(3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine (PubChem CID 89313765) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine.
Molecular Properties
| Compound Name | (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine |
| PubChem CID | 89313765 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine |
| SMILES | CCNC1C=CN=C[C@@H]1C |
| InChI | InChI=1S/C8H14N2/c1-3-10-8-4-5-9-6-7(8)2/h4-8,10H,3H2,1-2H3/t7-,8?/m0/s1 |
| InChIKey | KGDMJKDSTZLSDR-JAMMHHFISA-N |
| XLogP | 1.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine?
The IUPAC name of (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine (CID 89313765) is (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine.
What is the SMILES notation for (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine?
The canonical SMILES for (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine is CCNC1C=CN=C[C@@H]1C.
What is the InChIKey of (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine?
The InChIKey is KGDMJKDSTZLSDR-JAMMHHFISA-N. The full InChI is InChI=1S/C8H14N2/c1-3-10-8-4-5-9-6-7(8)2/h4-8,10H,3H2,1-2H3/t7-,8?/m0/s1.
What are the key properties of (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine?
(3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine has a molecular weight of 138.21 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine is sourced from PubChem (CID 89313765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).