C8H14N2 — CID 89313765
(3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine (PubChem CID 89313765) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine.
| Compound Name | (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine |
|---|---|
| PubChem CID | 89313765 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (3R)-N-ethyl-3-methyl-3,4-dihydropyridin-4-amine |
| SMILES | CCNC1C=CN=C[C@@H]1C |
| InChI | InChI=1S/C8H14N2/c1-3-10-8-4-5-9-6-7(8)2/h4-8,10H,3H2,1-2H3/t7-,8?/m0/s1 |
| InChIKey | KGDMJKDSTZLSDR-JAMMHHFISA-N |
| XLogP | 1.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |