About N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine
N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine (PubChem CID 70331366) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine.
Molecular Properties
| Compound Name | N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine |
| PubChem CID | 70331366 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine |
| SMILES | CCN(C)C1C=CN=CC1C |
| InChI | InChI=1S/C9H16N2/c1-4-11(3)9-5-6-10-7-8(9)2/h5-9H,4H2,1-3H3 |
| InChIKey | FJPXGIYFABVZJT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine?
The IUPAC name of N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine (CID 70331366) is N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine.
What is the SMILES notation for N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine?
The canonical SMILES for N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine is CCN(C)C1C=CN=CC1C.
What is the InChIKey of N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine?
The InChIKey is FJPXGIYFABVZJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-11(3)9-5-6-10-7-8(9)2/h5-9H,4H2,1-3H3.
What are the key properties of N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine?
N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine has a molecular weight of 152.24 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N,3-dimethyl-3,4-dihydropyridin-4-amine is sourced from PubChem (CID 70331366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).