About 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine
1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine (PubChem CID 123177997) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine.
Analyze 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine (CID 123177997) is 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine is CN(C)CC1C=CN=CC1.
What is the InChIKey of 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine?
The InChIKey is GUCNKEBPCCQXPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-10(2)7-8-3-5-9-6-4-8/h3,5-6,8H,4,7H2,1-2H3.
What are the key properties of 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine?
1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine has a molecular weight of 138.21 g/mol, XLogP of 1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydropyridin-4-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 123177997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).