C26H32N6O4 — CID 142948602
2,2-dimethyl-N-[2-[5-methyl-2-(3,4,5-trimethoxyanilino)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexa-2,4-dien-1-yl]propanamide (PubChem CID 142948602) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[5-methyl-2-(3,4,5-trimethoxyanilino)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexa-2,4-dien-1-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[5-methyl-2-(3,4,5-trimethoxyanilino)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexa-2,4-dien-1-yl]propanamide |
|---|---|
| PubChem CID | 142948602 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 2,2-dimethyl-N-[2-[5-methyl-2-(3,4,5-trimethoxyanilino)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexa-2,4-dien-1-yl]propanamide |
| SMILES | COc1cc(Nc2ncc3c(C)nc(C4=CC=CCC4NC(=O)C(C)(C)C)n3n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H32N6O4/c1-15-19-14-27-25(29-16-12-20(34-5)22(36-7)21(13-16)35-6)31-32(19)23(28-15)17-10-8-9-11-18(17)30-24(33)26(2,3)4/h8-10,12-14,18H,11H2,1-7H3,(H,29,31)(H,30,33) |
| InChIKey | ZOGMEKSBQUNQDO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |