C24H24N6O4 — CID 68869190
3-[3-[5-methyl-2-(3,4,5-trimethoxyanilino)imidazo[5,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide (PubChem CID 68869190) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is 3-[3-[5-methyl-2-(3,4,5-trimethoxyanilino)imidazo[5,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide.
| Compound Name | 3-[3-[5-methyl-2-(3,4,5-trimethoxyanilino)imidazo[5,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68869190 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 3-[3-[5-methyl-2-(3,4,5-trimethoxyanilino)imidazo[5,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide |
| SMILES | COc1cc(Nc2ncc3c(C)nc(-c4cccc(C=CC(N)=O)c4)n3n2)cc(OC)c1OC |
| InChI | InChI=1S/C24H24N6O4/c1-14-18-13-26-24(28-17-11-19(32-2)22(34-4)20(12-17)33-3)29-30(18)23(27-14)16-7-5-6-15(10-16)8-9-21(25)31/h5-13H,1-4H3,(H2,25,31)(H,28,29) |
| InChIKey | YEZRSDPKEDLNGE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|