C17H29NO — CID 142950424
1-[3-(3,4,4-trimethylcyclohexa-1,5-dien-1-yl)oxypropyl]piperidine (PubChem CID 142950424) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 1-[3-(3,4,4-trimethylcyclohexa-1,5-dien-1-yl)oxypropyl]piperidine.
| Compound Name | 1-[3-(3,4,4-trimethylcyclohexa-1,5-dien-1-yl)oxypropyl]piperidine |
|---|---|
| PubChem CID | 142950424 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-[3-(3,4,4-trimethylcyclohexa-1,5-dien-1-yl)oxypropyl]piperidine |
| SMILES | CC1C=C(OCCCN2CCCCC2)C=CC1(C)C |
| InChI | InChI=1S/C17H29NO/c1-15-14-16(8-9-17(15,2)3)19-13-7-12-18-10-5-4-6-11-18/h8-9,14-15H,4-7,10-13H2,1-3H3 |
| InChIKey | MGNJDHYTXTYLQJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|