About 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine
6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine (PubChem CID 142951473) has the molecular formula C13H11ClN4OP2
and a molecular weight of 336.66 g/mol. Its IUPAC name is 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine |
| PubChem CID | 142951473 |
| Molecular Formula | C13H11ClN4OP2 |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(Cl)nc2cnc(Oc3ccc(P)cc3P)cc12 |
| InChI | InChI=1S/C13H11ClN4OP2/c14-13-17-8-5-16-11(4-7(8)12(15)18-13)19-9-2-1-6(20)3-10(9)21/h1-5H,20-21H2,(H2,15,17,18) |
| InChIKey | XQFAFJWPWLYHAR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine?
The IUPAC name of 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine (CID 142951473) is 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine is Nc1nc(Cl)nc2cnc(Oc3ccc(P)cc3P)cc12.
What is the InChIKey of 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine?
The InChIKey is XQFAFJWPWLYHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN4OP2/c14-13-17-8-5-16-11(4-7(8)12(15)18-13)19-9-2-1-6(20)3-10(9)21/h1-5H,20-21H2,(H2,15,17,18).
What are the key properties of 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine?
6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine has a molecular weight of 336.66 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2,4-bis(phosphanyl)phenoxy]-2-chloropyrido[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 142951473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).