C13H12N4O2P2 — CID 142951468
N-[6-[2,4-bis(phosphanyl)phenoxy]pyrido[3,4-d]pyrimidin-2-yl]hydroxylamine (PubChem CID 142951468) has the molecular formula C13H12N4O2P2 and a molecular weight of 318.21 g/mol. Its IUPAC name is N-[6-[2,4-bis(phosphanyl)phenoxy]pyrido[3,4-d]pyrimidin-2-yl]hydroxylamine.
| Compound Name | N-[6-[2,4-bis(phosphanyl)phenoxy]pyrido[3,4-d]pyrimidin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 142951468 |
| Molecular Formula | C13H12N4O2P2 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-[6-[2,4-bis(phosphanyl)phenoxy]pyrido[3,4-d]pyrimidin-2-yl]hydroxylamine |
| SMILES | ONc1ncc2cc(Oc3ccc(P)cc3P)ncc2n1 |
| InChI | InChI=1S/C13H12N4O2P2/c18-17-13-15-5-7-3-12(14-6-9(7)16-13)19-10-2-1-8(20)4-11(10)21/h1-6,18H,20-21H2,(H,15,16,17) |
| InChIKey | WFAZXKAVCGGTKG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|