About ethane;ethyl formate;1-ethylindol-5-ol
ethane;ethyl formate;1-ethylindol-5-ol (PubChem CID 142952084) has the molecular formula C15H23NO3
and a molecular weight of 265.35 g/mol. Its IUPAC name is ethane;ethyl formate;1-ethylindol-5-ol.
Molecular Properties
| Compound Name | ethane;ethyl formate;1-ethylindol-5-ol |
| PubChem CID | 142952084 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | ethane;ethyl formate;1-ethylindol-5-ol |
| SMILES | CC.CCOC=O.CCn1ccc2cc(O)ccc21 |
| InChI | InChI=1S/C10H11NO.C3H6O2.C2H6/c1-2-11-6-5-8-7-9(12)3-4-10(8)11;1-2-5-3-4;1-2/h3-7,12H,2H2,1H3;3H,2H2,1H3;1-2H3 |
| InChIKey | DTAOOJOSBLGCRA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl formate;1-ethylindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl formate;1-ethylindol-5-ol?
The IUPAC name of ethane;ethyl formate;1-ethylindol-5-ol (CID 142952084) is ethane;ethyl formate;1-ethylindol-5-ol.
What is the SMILES notation for ethane;ethyl formate;1-ethylindol-5-ol?
The canonical SMILES for ethane;ethyl formate;1-ethylindol-5-ol is CC.CCOC=O.CCn1ccc2cc(O)ccc21.
What is the InChIKey of ethane;ethyl formate;1-ethylindol-5-ol?
The InChIKey is DTAOOJOSBLGCRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.C3H6O2.C2H6/c1-2-11-6-5-8-7-9(12)3-4-10(8)11;1-2-5-3-4;1-2/h3-7,12H,2H2,1H3;3H,2H2,1H3;1-2H3.
What are the key properties of ethane;ethyl formate;1-ethylindol-5-ol?
ethane;ethyl formate;1-ethylindol-5-ol has a molecular weight of 265.35 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl formate;1-ethylindol-5-ol is sourced from PubChem (CID 142952084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).