C21H25N3O4 — CID 142955407
2-(ethylamino)-3-[(2-ethyl-6-methylphenyl)methylcarbamoylcarbamoyl]benzoic acid (PubChem CID 142955407) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-(ethylamino)-3-[(2-ethyl-6-methylphenyl)methylcarbamoylcarbamoyl]benzoic acid.
| Compound Name | 2-(ethylamino)-3-[(2-ethyl-6-methylphenyl)methylcarbamoylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 142955407 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-(ethylamino)-3-[(2-ethyl-6-methylphenyl)methylcarbamoylcarbamoyl]benzoic acid |
| SMILES | CCNc1c(C(=O)O)cccc1C(=O)NC(=O)NCc1c(C)cccc1CC |
| InChI | InChI=1S/C21H25N3O4/c1-4-14-9-6-8-13(3)17(14)12-23-21(28)24-19(25)15-10-7-11-16(20(26)27)18(15)22-5-2/h6-11,22H,4-5,12H2,1-3H3,(H,26,27)(H2,23,24,25,28) |
| InChIKey | XOTBIUGIKNSPLF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |