C18H19N3O4 — CID 142955410
3-amino-2-[(2,6-dimethylphenyl)methylcarbamoylcarbamoyl]benzoic acid (PubChem CID 142955410) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-amino-2-[(2,6-dimethylphenyl)methylcarbamoylcarbamoyl]benzoic acid.
| Compound Name | 3-amino-2-[(2,6-dimethylphenyl)methylcarbamoylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 142955410 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-amino-2-[(2,6-dimethylphenyl)methylcarbamoylcarbamoyl]benzoic acid |
| SMILES | Cc1cccc(C)c1CNC(=O)NC(=O)c1c(N)cccc1C(=O)O |
| InChI | InChI=1S/C18H19N3O4/c1-10-5-3-6-11(2)13(10)9-20-18(25)21-16(22)15-12(17(23)24)7-4-8-14(15)19/h3-8H,9,19H2,1-2H3,(H,23,24)(H2,20,21,22,25) |
| InChIKey | OUWMALLWFMZTEM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|